C15H22N4O2 — CID 131646984
4-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 131646984) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 131646984 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COCC1CN(Cc2c(C)noc2C)Cc2cncn2C1 |
| InChI | InChI=1S/C15H22N4O2/c1-11-15(12(2)21-17-11)8-18-5-13(9-20-3)6-19-10-16-4-14(19)7-18/h4,10,13H,5-9H2,1-3H3 |
| InChIKey | FYSQWVBRBWIQSO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |