C16H23N5O — CID 131647251
8-[(1-methylpyrazol-4-yl)methyl]-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 131647251) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 8-[(1-methylpyrazol-4-yl)methyl]-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 8-[(1-methylpyrazol-4-yl)methyl]-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 131647251 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 8-[(1-methylpyrazol-4-yl)methyl]-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | C=CCOCC1CN(Cc2cnn(C)c2)Cc2nccn2C1 |
| InChI | InChI=1S/C16H23N5O/c1-3-6-22-13-15-10-20(9-14-7-18-19(2)8-14)12-16-17-4-5-21(16)11-15/h3-5,7-8,15H,1,6,9-13H2,2H3 |
| InChIKey | XEDPVOKCJHFPCK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|