C18H25FN2O2 — CID 131648399
1-[7-[(dimethylamino)methyl]-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 131648399) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[7-[(dimethylamino)methyl]-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[7-[(dimethylamino)methyl]-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 131648399 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-[7-[(dimethylamino)methyl]-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | CN(C)CC1CCC2(CN(C(=O)Cc3ccccc3F)C2)OC1 |
| InChI | InChI=1S/C18H25FN2O2/c1-20(2)10-14-7-8-18(23-11-14)12-21(13-18)17(22)9-15-5-3-4-6-16(15)19/h3-6,14H,7-13H2,1-2H3 |
| InChIKey | QTZKKVKHQDHZSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |