C16H27NO5S — CID 131650668
1-[4a-(cyclopropylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-methylsulfonylethanone (PubChem CID 131650668) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[4a-(cyclopropylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[4a-(cyclopropylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 131650668 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[4a-(cyclopropylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)N1CCC2OCCCC2(COCC2CC2)C1 |
| InChI | InChI=1S/C16H27NO5S/c1-23(19,20)10-15(18)17-7-5-14-16(11-17,6-2-8-22-14)12-21-9-13-3-4-13/h13-14H,2-12H2,1H3 |
| InChIKey | COSOKVHSNAJQDH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |