C16H24N4O2 — CID 131651095
4-[[6-(ethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 131651095) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[[6-(ethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[6-(ethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 131651095 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-[[6-(ethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | CCOCC1CN(Cc2c(C)noc2C)Cc2cncn2C1 |
| InChI | InChI=1S/C16H24N4O2/c1-4-21-10-14-6-19(8-15-5-17-11-20(15)7-14)9-16-12(2)18-22-13(16)3/h5,11,14H,4,6-10H2,1-3H3 |
| InChIKey | CCKCYWNGSYGSGU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |