C21H22Cl2N2O — CID 131651326
2-(4-chlorophenyl)-1-[2-[(3-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone (PubChem CID 131651326) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[2-[(3-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[2-[(3-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 131651326 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[2-[(3-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CC2CN(Cc3cccc(Cl)c3)CC2C1 |
| InChI | InChI=1S/C21H22Cl2N2O/c22-19-6-4-15(5-7-19)9-21(26)25-13-17-11-24(12-18(17)14-25)10-16-2-1-3-20(23)8-16/h1-8,17-18H,9-14H2 |
| InChIKey | QMUVPSDUWGLZLP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |