C17H26N2O3 — CID 131651440
8-(2-methoxyethyl)-2-[(2-methoxy-3-pyridinyl)methyl]-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 131651440) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 8-(2-methoxyethyl)-2-[(2-methoxy-3-pyridinyl)methyl]-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | 8-(2-methoxyethyl)-2-[(2-methoxy-3-pyridinyl)methyl]-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 131651440 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 8-(2-methoxyethyl)-2-[(2-methoxy-3-pyridinyl)methyl]-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | COCCC1CCOC2(C1)CN(Cc1cccnc1OC)C2 |
| InChI | InChI=1S/C17H26N2O3/c1-20-8-5-14-6-9-22-17(10-14)12-19(13-17)11-15-4-3-7-18-16(15)21-2/h3-4,7,14H,5-6,8-13H2,1-2H3 |
| InChIKey | JTFLQLOKUJPIIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |