C18H25NO4 — CID 131652733
[3-(cyclopropylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(2-methylfuran-3-yl)methanone (PubChem CID 131652733) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [3-(cyclopropylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(2-methylfuran-3-yl)methanone.
| Compound Name | [3-(cyclopropylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 131652733 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [3-(cyclopropylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CCC2(CC1)CC(OCC1CC1)CO2 |
| InChI | InChI=1S/C18H25NO4/c1-13-16(4-9-21-13)17(20)19-7-5-18(6-8-19)10-15(12-23-18)22-11-14-2-3-14/h4,9,14-15H,2-3,5-8,10-12H2,1H3 |
| InChIKey | GQMVXWPGOPWLHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |