C19H25N3O — CID 131655516
1'-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-methylspiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine] (PubChem CID 131655516) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 1'-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-methylspiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine].
| Compound Name | 1'-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-methylspiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine] |
|---|---|
| PubChem CID | 131655516 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1'-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-methylspiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine] |
| SMILES | Cc1ncc2c(n1)C1(CCN(C[C@H]3C[C@@H]4C=C[C@H]3C4)C1)COC2 |
| InChI | InChI=1S/C19H25N3O/c1-13-20-8-17-10-23-12-19(18(17)21-13)4-5-22(11-19)9-16-7-14-2-3-15(16)6-14/h2-3,8,14-16H,4-7,9-12H2,1H3/t14-,15+,16-,19?/m1/s1 |
| InChIKey | LKRKJFLPKCDCOQ-ONXYJPLBSA-N |
| XLogP | 2.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|