C16H17F3N2O2 — CID 131657294
4-phenyl-7-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131657294) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-phenyl-7-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 4-phenyl-7-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131657294 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-phenyl-7-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC2(C1)C(=O)NCC2c1ccccc1 |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)8-13(22)21-7-6-15(10-21)12(9-20-14(15)23)11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,20,23) |
| InChIKey | AXIICCZHRTUURL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |