C18H21N3O3S — CID 131657853
4-[methyl(pyridin-3-ylmethyl)amino]-1-(thiophene-3-carbonyl)piperidine-2-carboxylic acid (PubChem CID 131657853) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[methyl(pyridin-3-ylmethyl)amino]-1-(thiophene-3-carbonyl)piperidine-2-carboxylic acid.
| Compound Name | 4-[methyl(pyridin-3-ylmethyl)amino]-1-(thiophene-3-carbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 131657853 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[methyl(pyridin-3-ylmethyl)amino]-1-(thiophene-3-carbonyl)piperidine-2-carboxylic acid |
| SMILES | CN(Cc1cccnc1)C1CCN(C(=O)c2ccsc2)C(C(=O)O)C1 |
| InChI | InChI=1S/C18H21N3O3S/c1-20(11-13-3-2-6-19-10-13)15-4-7-21(16(9-15)18(23)24)17(22)14-5-8-25-12-14/h2-3,5-6,8,10,12,15-16H,4,7,9,11H2,1H3,(H,23,24) |
| InChIKey | RNLDOUCUTGNKBY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |