About 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide
1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide (PubChem CID 131658736) has the molecular formula C25H25N3O2
and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide |
| PubChem CID | 131658736 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3(CO2)CN(Cc2ccccc2)c2ccccc23)nc1 |
| InChI | InChI=1S/C25H25N3O2/c1-18-11-12-23(26-14-18)27-24(29)22-13-25(17-30-22)16-28(15-19-7-3-2-4-8-19)21-10-6-5-9-20(21)25/h2-12,14,22H,13,15-17H2,1H3,(H,26,27,29) |
| InChIKey | WUAVNSYIZCOIHU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide?
The IUPAC name of 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide (CID 131658736) is 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide.
What is the SMILES notation for 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide?
The canonical SMILES for 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide is Cc1ccc(NC(=O)C2CC3(CO2)CN(Cc2ccccc2)c2ccccc23)nc1.
What is the InChIKey of 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide?
The InChIKey is WUAVNSYIZCOIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O2/c1-18-11-12-23(26-14-18)27-24(29)22-13-25(17-30-22)16-28(15-19-7-3-2-4-8-19)21-10-6-5-9-20(21)25/h2-12,14,22H,13,15-17H2,1H3,(H,26,27,29).
What are the key properties of 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide?
1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide has a molecular weight of 399.49 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-(5-methyl-2-pyridinyl)spiro[2H-indole-3,4'-oxolane]-2'-carboxamide is sourced from PubChem (CID 131658736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).