C15H21N5OS — CID 131660712
2-[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-5-methyl-1,3,4-thiadiazole (PubChem CID 131660712) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 131660712 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2Cc3cncn3CC(COCC3CC3)C2)s1 |
| InChI | InChI=1S/C15H21N5OS/c1-11-17-18-15(22-11)19-5-13(9-21-8-12-2-3-12)6-20-10-16-4-14(20)7-19/h4,10,12-13H,2-3,5-9H2,1H3 |
| InChIKey | RBNOUMBKPLTRIO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |