About 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol
4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol (PubChem CID 13166100) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol.
Molecular Properties
| Compound Name | 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol |
| PubChem CID | 13166100 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol |
| SMILES | CCC1=[N+]([O-])OC2(O)CCC(C)(C)C1C2 |
| InChI | InChI=1S/C11H19NO3/c1-4-9-8-7-11(13,15-12(9)14)6-5-10(8,2)3/h8,13H,4-7H2,1-3H3 |
| InChIKey | JUWXXJULPWYOIM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol?
The IUPAC name of 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol (CID 13166100) is 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol.
What is the SMILES notation for 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol?
The canonical SMILES for 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol is CCC1=[N+]([O-])OC2(O)CCC(C)(C)C1C2.
What is the InChIKey of 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol?
The InChIKey is JUWXXJULPWYOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-4-9-8-7-11(13,15-12(9)14)6-5-10(8,2)3/h8,13H,4-7H2,1-3H3.
What are the key properties of 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol?
4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol has a molecular weight of 213.28 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6,6-dimethyl-3-oxido-2-oxa-3-azoniabicyclo[3.3.1]non-3-en-1-ol is sourced from PubChem (CID 13166100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).