About 2,3-diphenylthiomorpholine
2,3-diphenylthiomorpholine (PubChem CID 13166168) has the molecular formula C16H17NS
and a molecular weight of 255.39 g/mol. Its IUPAC name is 2,3-diphenylthiomorpholine.
Molecular Properties
| Compound Name | 2,3-diphenylthiomorpholine |
| PubChem CID | 13166168 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,3-diphenylthiomorpholine |
| SMILES | c1ccc(C2NCCSC2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NS/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2 |
| InChIKey | KMAWGPSBGXQDPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diphenylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylthiomorpholine?
The IUPAC name of 2,3-diphenylthiomorpholine (CID 13166168) is 2,3-diphenylthiomorpholine.
What is the SMILES notation for 2,3-diphenylthiomorpholine?
The canonical SMILES for 2,3-diphenylthiomorpholine is c1ccc(C2NCCSC2c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenylthiomorpholine?
The InChIKey is KMAWGPSBGXQDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NS/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2.
What are the key properties of 2,3-diphenylthiomorpholine?
2,3-diphenylthiomorpholine has a molecular weight of 255.39 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylthiomorpholine is sourced from PubChem (CID 13166168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).