C13H21N3O2S — CID 131662739
4a-(methoxymethyl)-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 131662739) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 4a-(methoxymethyl)-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | 4a-(methoxymethyl)-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 131662739 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4a-(methoxymethyl)-6-(5-methyl-1,3,4-thiadiazol-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | COCC12CCCOC1CCN(c1nnc(C)s1)C2 |
| InChI | InChI=1S/C13H21N3O2S/c1-10-14-15-12(19-10)16-6-4-11-13(8-16,9-17-2)5-3-7-18-11/h11H,3-9H2,1-2H3 |
| InChIKey | ZBQLYDLQCJEDKS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |