C17H23N3O2 — CID 131663860
N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)pyrrolidine-1-carboxamide (PubChem CID 131663860) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 131663860 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)pyrrolidine-1-carboxamide |
| SMILES | C=CCn1c2c(ccc1=O)CC(NC(=O)N1CCCC1)CC2 |
| InChI | InChI=1S/C17H23N3O2/c1-2-9-20-15-7-6-14(12-13(15)5-8-16(20)21)18-17(22)19-10-3-4-11-19/h2,5,8,14H,1,3-4,6-7,9-12H2,(H,18,22) |
| InChIKey | HNDBJNHKAONTLU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|