C21H25IN2O2 — CID 131665188
(1R,11S,12Z,17S)-14-ethyl-12-ethylidene-10-formyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraen-6-olate;hydroiodide (PubChem CID 131665188) has the molecular formula C21H25IN2O2 and a molecular weight of 464.35 g/mol. Its IUPAC name is (1R,11S,12Z,17S)-14-ethyl-12-ethylidene-10-formyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraen-6-olate;hydroiodide.
| Compound Name | (1R,11S,12Z,17S)-14-ethyl-12-ethylidene-10-formyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraen-6-olate;hydroiodide |
|---|---|
| PubChem CID | 131665188 |
| Molecular Formula | C21H25IN2O2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (1R,11S,12Z,17S)-14-ethyl-12-ethylidene-10-formyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraen-6-olate;hydroiodide |
| SMILES | C/C=C1\C[N+]2(CC)CC[C@]34C(=C(C=O)[C@H]1C[C@@H]32)Nc1c([O-])cccc14.I |
| InChI | InChI=1S/C21H24N2O2.HI/c1-3-13-11-23(4-2)9-8-21-16-6-5-7-17(25)19(16)22-20(21)15(12-24)14(13)10-18(21)23;/h3,5-7,12,14,18H,4,8-11H2,1-2H3,(H-,22,24,25);1H/b13-3+;/t14-,18-,21+,23?;/m0./s1 |
| InChIKey | DWSMYYYPZHBSDY-GEXHJKCRSA-N |
| XLogP | 3.08 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|