C21H21ClFN3O — CID 131666359
N-(2-fluorophenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride (PubChem CID 131666359) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride.
| Compound Name | N-(2-fluorophenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 131666359 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
| SMILES | Cc1ccc(-c2c[n+](C/C([O-])=N/c3ccccc3F)c3n2CCC3)cc1.Cl |
| InChI | InChI=1S/C21H20FN3O.ClH/c1-15-8-10-16(11-9-15)19-13-24(21-7-4-12-25(19)21)14-20(26)23-18-6-3-2-5-17(18)22;/h2-3,5-6,8-11,13H,4,7,12,14H2,1H3;1H |
| InChIKey | XPWLUTFMFQLOQT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|