C22H22Cl3N3O — CID 131666362
2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(2-ethylphenyl)ethanimidate;hydrochloride (PubChem CID 131666362) has the molecular formula C22H22Cl3N3O and a molecular weight of 450.80 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(2-ethylphenyl)ethanimidate;hydrochloride.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(2-ethylphenyl)ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 131666362 |
| Molecular Formula | C22H22Cl3N3O |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(2-ethylphenyl)ethanimidate;hydrochloride |
| SMILES | CCc1ccccc1/N=C(\[O-])C[n+]1cc(-c2ccc(Cl)c(Cl)c2)n2c1CCC2.Cl |
| InChI | InChI=1S/C22H21Cl2N3O.ClH/c1-2-15-6-3-4-7-19(15)25-21(28)14-26-13-20(27-11-5-8-22(26)27)16-9-10-17(23)18(24)12-16;/h3-4,6-7,9-10,12-13H,2,5,8,11,14H2,1H3;1H |
| InChIKey | JVFPOKQWIQNSJK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|