C5H6N2 — CID 131667567
N,1,2,3,5,6-hexadeuteriopyridin-4-imine (PubChem CID 131667567) has the molecular formula C5H6N2 and a molecular weight of 100.15 g/mol. Its IUPAC name is N,1,2,3,5,6-hexadeuteriopyridin-4-imine.
| Compound Name | N,1,2,3,5,6-hexadeuteriopyridin-4-imine |
|---|---|
| PubChem CID | 131667567 |
| Molecular Formula | C5H6N2 |
| Molecular Weight | 100.15 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | N,1,2,3,5,6-hexadeuteriopyridin-4-imine |
| SMILES | [2H]N=c1c([2H])c([2H])n([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C5H6N2/c6-5-1-3-7-4-2-5/h1-4H,(H2,6,7)/i1D,2D,3D,4D/hD2 |
| InChIKey | NUKYPUAOHBNCPY-UDDMDDBKSA-N |
| XLogP | 0.49 |
| TPSA | 39.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |