C8H12N2 — CID 131668073
3,5-dimethyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrazine (PubChem CID 131668073) has the molecular formula C8H12N2 and a molecular weight of 141.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrazine.
| Compound Name | 3,5-dimethyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrazine |
|---|---|
| PubChem CID | 131668073 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 141.23 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 3,5-dimethyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrazine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1ncc(C)nc1C |
| InChI | InChI=1S/C8H12N2/c1-4-8-7(3)10-6(2)5-9-8/h5H,4H2,1-3H3/i1D3,4D2 |
| InChIKey | JZBCTZLGKSYRSF-SGEUAGPISA-N |
| XLogP | 1.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |