C10H9ClN4S — CID 131668399
[3-[(6-chloro-3-pyridinyl)methyl]-4,4,5,5-tetradeuterio-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 131668399) has the molecular formula C10H9ClN4S and a molecular weight of 256.75 g/mol. Its IUPAC name is [3-[(6-chloro-3-pyridinyl)methyl]-4,4,5,5-tetradeuterio-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | [3-[(6-chloro-3-pyridinyl)methyl]-4,4,5,5-tetradeuterio-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 131668399 |
| Molecular Formula | C10H9ClN4S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [3-[(6-chloro-3-pyridinyl)methyl]-4,4,5,5-tetradeuterio-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | [2H]C1([2H])S/C(=N\C#N)N(Cc2ccc(Cl)nc2)C1([2H])[2H] |
| InChI | InChI=1S/C10H9ClN4S/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12/h1-2,5H,3-4,6H2/b14-10-/i3D2,4D2 |
| InChIKey | HOKKPVIRMVDYPB-NPNQNPJSSA-N |
| XLogP | 2.12 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|