About 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide
8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide (PubChem CID 131669147) has the molecular formula C12H14F3N3O5S2
and a molecular weight of 401.39 g/mol. Its IUPAC name is 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide.
Molecular Properties
| Compound Name | 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide |
| PubChem CID | 131669147 |
| Molecular Formula | C12H14F3N3O5S2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide |
| SMILES | O=S1(=O)CCC(COc2ncccn2)C12CN(S(=O)(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C12H14F3N3O5S2/c13-12(14,15)25(21,22)18-7-11(8-18)9(2-5-24(11,19)20)6-23-10-16-3-1-4-17-10/h1,3-4,9H,2,5-8H2 |
| InChIKey | OUCBPILZYDJMPC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The IUPAC name of 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide (CID 131669147) is 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide.
What is the SMILES notation for 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The canonical SMILES for 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide is O=S1(=O)CCC(COc2ncccn2)C12CN(S(=O)(=O)C(F)(F)F)C2.
What is the InChIKey of 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
The InChIKey is OUCBPILZYDJMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O5S2/c13-12(14,15)25(21,22)18-7-11(8-18)9(2-5-24(11,19)20)6-23-10-16-3-1-4-17-10/h1,3-4,9H,2,5-8H2.
What are the key properties of 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide?
8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide has a molecular weight of 401.39 g/mol, XLogP of 0.19, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(pyrimidin-2-yloxymethyl)-2-(trifluoromethylsulfonyl)-5λ6-thia-2-azaspiro[3.4]octane 5,5-dioxide is sourced from PubChem (CID 131669147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).