C16H20FN5O — CID 131669432
7-[2-(cyclopropylmethoxy)ethyl]-5-(5-fluoropyrimidin-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 131669432) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 7-[2-(cyclopropylmethoxy)ethyl]-5-(5-fluoropyrimidin-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 7-[2-(cyclopropylmethoxy)ethyl]-5-(5-fluoropyrimidin-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 131669432 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 7-[2-(cyclopropylmethoxy)ethyl]-5-(5-fluoropyrimidin-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | Fc1cnc(N2Cc3ccnn3C(CCOCC3CC3)C2)nc1 |
| InChI | InChI=1S/C16H20FN5O/c17-13-7-18-16(19-8-13)21-9-14-3-5-20-22(14)15(10-21)4-6-23-11-12-1-2-12/h3,5,7-8,12,15H,1-2,4,6,9-11H2 |
| InChIKey | FHEHATYAJNWFNU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|