C11H12O2 — CID 13166975
tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol (PubChem CID 13166975) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol.
| Compound Name | tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol |
|---|---|
| PubChem CID | 13166975 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol |
| SMILES | OC1C2CC(c3ccccc32)C1O |
| InChI | InChI=1S/C11H12O2/c12-10-8-5-9(11(10)13)7-4-2-1-3-6(7)8/h1-4,8-13H,5H2 |
| InChIKey | KKBAQAHAWLUGNK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |