C24H35N5O2 — CID 131670094
N-butan-2-yl-1'-[(4-ethylphenyl)methyl]spiro[7,9-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazepine-6,4'-piperidine]-3-carboxamide (PubChem CID 131670094) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-butan-2-yl-1'-[(4-ethylphenyl)methyl]spiro[7,9-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazepine-6,4'-piperidine]-3-carboxamide.
| Compound Name | N-butan-2-yl-1'-[(4-ethylphenyl)methyl]spiro[7,9-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazepine-6,4'-piperidine]-3-carboxamide |
|---|---|
| PubChem CID | 131670094 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N-butan-2-yl-1'-[(4-ethylphenyl)methyl]spiro[7,9-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazepine-6,4'-piperidine]-3-carboxamide |
| SMILES | CCc1ccc(CN2CCC3(CC2)COCc2nnc(C(=O)NC(C)CC)n2C3)cc1 |
| InChI | InChI=1S/C24H35N5O2/c1-4-18(3)25-23(30)22-27-26-21-15-31-17-24(16-29(21)22)10-12-28(13-11-24)14-20-8-6-19(5-2)7-9-20/h6-9,18H,4-5,10-17H2,1-3H3,(H,25,30) |
| InChIKey | NIWDDFHDAMGQAP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |