C21H25ClN4O3 — CID 131670146
1'-[(3-chlorophenyl)methyl]-2-cyclopentylspiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione (PubChem CID 131670146) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 1'-[(3-chlorophenyl)methyl]-2-cyclopentylspiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione.
| Compound Name | 1'-[(3-chlorophenyl)methyl]-2-cyclopentylspiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
|---|---|
| PubChem CID | 131670146 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1'-[(3-chlorophenyl)methyl]-2-cyclopentylspiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
| SMILES | O=c1c(=O)n2c(nn1C1CCCC1)COC1(CCN(Cc3cccc(Cl)c3)C1)C2 |
| InChI | InChI=1S/C21H25ClN4O3/c22-16-5-3-4-15(10-16)11-24-9-8-21(13-24)14-25-18(12-29-21)23-26(20(28)19(25)27)17-6-1-2-7-17/h3-5,10,17H,1-2,6-9,11-14H2 |
| InChIKey | NLNTYQYDZTYKDA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|