About 2-(2,2-dimethoxyethyl)-1,3-dithiane
2-(2,2-dimethoxyethyl)-1,3-dithiane (PubChem CID 13167015) has the molecular formula C8H16O2S2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethyl)-1,3-dithiane |
| PubChem CID | 13167015 |
| Molecular Formula | C8H16O2S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-1,3-dithiane |
| SMILES | COC(CC1SCCCS1)OC |
| InChI | InChI=1S/C8H16O2S2/c1-9-7(10-2)6-8-11-4-3-5-12-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | DMCSXYLJSVMMAS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethyl)-1,3-dithiane?
The IUPAC name of 2-(2,2-dimethoxyethyl)-1,3-dithiane (CID 13167015) is 2-(2,2-dimethoxyethyl)-1,3-dithiane.
What is the SMILES notation for 2-(2,2-dimethoxyethyl)-1,3-dithiane?
The canonical SMILES for 2-(2,2-dimethoxyethyl)-1,3-dithiane is COC(CC1SCCCS1)OC.
What is the InChIKey of 2-(2,2-dimethoxyethyl)-1,3-dithiane?
The InChIKey is DMCSXYLJSVMMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S2/c1-9-7(10-2)6-8-11-4-3-5-12-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-(2,2-dimethoxyethyl)-1,3-dithiane?
2-(2,2-dimethoxyethyl)-1,3-dithiane has a molecular weight of 208.35 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethyl)-1,3-dithiane is sourced from PubChem (CID 13167015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).