About (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one
(1S,6R)-tricyclo[4.3.1.01,6]decan-7-one (PubChem CID 13167045) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one.
Molecular Properties
| Compound Name | (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one |
| PubChem CID | 13167045 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one |
| SMILES | O=C1CC[C@]23CCCC[C@]12C3 |
| InChI | InChI=1S/C10H14O/c11-8-3-6-9-4-1-2-5-10(8,9)7-9/h1-7H2/t9-,10-/m0/s1 |
| InChIKey | ZZHOIPXKSGRVSS-UWVGGRQHSA-N |
| XLogP | 2.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one?
The IUPAC name of (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one (CID 13167045) is (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one.
What is the SMILES notation for (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one?
The canonical SMILES for (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one is O=C1CC[C@]23CCCC[C@]12C3.
What is the InChIKey of (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one?
The InChIKey is ZZHOIPXKSGRVSS-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H14O/c11-8-3-6-9-4-1-2-5-10(8,9)7-9/h1-7H2/t9-,10-/m0/s1.
What are the key properties of (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one?
(1S,6R)-tricyclo[4.3.1.01,6]decan-7-one has a molecular weight of 150.22 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-tricyclo[4.3.1.01,6]decan-7-one is sourced from PubChem (CID 13167045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).