C22H29N5O2S — CID 131671177
8-oxo-N-propan-2-yl-11-(thiophen-2-ylmethyl)spiro[2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-diene-4,3'-pyrrolidine]-1'-carboxamide (PubChem CID 131671177) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 8-oxo-N-propan-2-yl-11-(thiophen-2-ylmethyl)spiro[2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-diene-4,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | 8-oxo-N-propan-2-yl-11-(thiophen-2-ylmethyl)spiro[2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-diene-4,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 131671177 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 8-oxo-N-propan-2-yl-11-(thiophen-2-ylmethyl)spiro[2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-diene-4,3'-pyrrolidine]-1'-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC2(CCn3c2nc2c(c3=O)CN(Cc3cccs3)CC2)C1 |
| InChI | InChI=1S/C22H29N5O2S/c1-15(2)23-21(29)26-9-6-22(14-26)7-10-27-19(28)17-13-25(12-16-4-3-11-30-16)8-5-18(17)24-20(22)27/h3-4,11,15H,5-10,12-14H2,1-2H3,(H,23,29) |
| InChIKey | KZJVKKJMXIGRBH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |