C23H29N3O — CID 131673233
3a-phenyl-1-propan-2-yl-6-(pyridin-4-ylmethyl)-2,3,4,5,8,8a-hexahydropyrrolo[2,3-d]azepin-7-one (PubChem CID 131673233) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 3a-phenyl-1-propan-2-yl-6-(pyridin-4-ylmethyl)-2,3,4,5,8,8a-hexahydropyrrolo[2,3-d]azepin-7-one.
| Compound Name | 3a-phenyl-1-propan-2-yl-6-(pyridin-4-ylmethyl)-2,3,4,5,8,8a-hexahydropyrrolo[2,3-d]azepin-7-one |
|---|---|
| PubChem CID | 131673233 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 3a-phenyl-1-propan-2-yl-6-(pyridin-4-ylmethyl)-2,3,4,5,8,8a-hexahydropyrrolo[2,3-d]azepin-7-one |
| SMILES | CC(C)N1CCC2(c3ccccc3)CCN(Cc3ccncc3)C(=O)CC12 |
| InChI | InChI=1S/C23H29N3O/c1-18(2)26-15-11-23(20-6-4-3-5-7-20)10-14-25(22(27)16-21(23)26)17-19-8-12-24-13-9-19/h3-9,12-13,18,21H,10-11,14-17H2,1-2H3 |
| InChIKey | UDMSCPZDEJHFCF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |