About sodium;dihydrogen borate;hydrate
sodium;dihydrogen borate;hydrate (PubChem CID 131674097) has the molecular formula H4BNaO4
and a molecular weight of 101.83 g/mol. Its IUPAC name is sodium;dihydrogen borate;hydrate.
Molecular Properties
| Compound Name | sodium;dihydrogen borate;hydrate |
| PubChem CID | 131674097 |
| Molecular Formula | H4BNaO4 |
| Molecular Weight | 101.83 g/mol |
| Exact Mass | 102.01 |
| IUPAC Name | sodium;dihydrogen borate;hydrate |
| SMILES | O.[Na+].[O-]B(O)O |
| InChI | InChI=1S/BH2O3.Na.H2O/c2-1(3)4;;/h2-3H;;1H2/q-1;+1; |
| InChIKey | ROTJXNFTKBUGIS-UHFFFAOYSA-N |
| XLogP | -6.50 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.83 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;dihydrogen borate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dihydrogen borate;hydrate?
The IUPAC name of sodium;dihydrogen borate;hydrate (CID 131674097) is sodium;dihydrogen borate;hydrate.
What is the SMILES notation for sodium;dihydrogen borate;hydrate?
The canonical SMILES for sodium;dihydrogen borate;hydrate is O.[Na+].[O-]B(O)O.
What is the InChIKey of sodium;dihydrogen borate;hydrate?
The InChIKey is ROTJXNFTKBUGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/BH2O3.Na.H2O/c2-1(3)4;;/h2-3H;;1H2/q-1;+1;.
What are the key properties of sodium;dihydrogen borate;hydrate?
sodium;dihydrogen borate;hydrate has a molecular weight of 101.83 g/mol, XLogP of -6.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dihydrogen borate;hydrate is sourced from PubChem (CID 131674097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).