C10H24N4 — CID 131674238
3-[4-(3-aminopropyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]propan-1-amine (PubChem CID 131674238) has the molecular formula C10H24N4 and a molecular weight of 208.38 g/mol. Its IUPAC name is 3-[4-(3-aminopropyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]propan-1-amine.
| Compound Name | 3-[4-(3-aminopropyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 131674238 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.25 |
| IUPAC Name | 3-[4-(3-aminopropyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]propan-1-amine |
| SMILES | [2H]C1([2H])N(CCCN)C([2H])([2H])C([2H])([2H])N(CCCN)C1([2H])[2H] |
| InChI | InChI=1S/C10H24N4/c11-3-1-5-13-7-9-14(10-8-13)6-2-4-12/h1-12H2/i7D2,8D2,9D2,10D2 |
| InChIKey | XUSNPFGLKGCWGN-UFBJYANTSA-N |
| XLogP | -0.70 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |