C7H6BCl2FO2 — CID 131676872
(2,3-dichloro-6-fluoro-4-methylphenyl)boronic acid (PubChem CID 131676872) has the molecular formula C7H6BCl2FO2 and a molecular weight of 222.84 g/mol. Its IUPAC name is (2,3-dichloro-6-fluoro-4-methylphenyl)boronic acid.
| Compound Name | (2,3-dichloro-6-fluoro-4-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 131676872 |
| Molecular Formula | C7H6BCl2FO2 |
| Molecular Weight | 222.84 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | (2,3-dichloro-6-fluoro-4-methylphenyl)boronic acid |
| SMILES | Cc1cc(F)c(B(O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C7H6BCl2FO2/c1-3-2-4(11)5(8(12)13)7(10)6(3)9/h2,12-13H,1H3 |
| InChIKey | YQRVWJNOUBYNBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.84 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|