C20H19NO4S — CID 13167703
(Z)-but-2-enedioic acid;2-thia-12-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaene (PubChem CID 13167703) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-thia-12-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaene.
| Compound Name | (Z)-but-2-enedioic acid;2-thia-12-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaene |
|---|---|
| PubChem CID | 13167703 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-thia-12-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaene |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc2c(c1)CC1CNCc3cccc(c31)S2 |
| InChI | InChI=1S/C16H15NS.C4H4O4/c1-2-6-14-11(4-1)8-13-10-17-9-12-5-3-7-15(18-14)16(12)13;5-3(6)1-2-4(7)8/h1-7,13,17H,8-10H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | AQQSBMUTIZCLBU-BTJKTKAUSA-N |
| XLogP | 3.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|