C19H24N2O4S — CID 131677257
N-[2-[2-(furan-2-ylmethyl)-5-oxa-2-azaspiro[3.4]octan-8-yl]ethyl]benzenesulfonamide (PubChem CID 131677257) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[2-[2-(furan-2-ylmethyl)-5-oxa-2-azaspiro[3.4]octan-8-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(furan-2-ylmethyl)-5-oxa-2-azaspiro[3.4]octan-8-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 131677257 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-[2-(furan-2-ylmethyl)-5-oxa-2-azaspiro[3.4]octan-8-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1CCOC12CN(Cc1ccco1)C2)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O4S/c22-26(23,18-6-2-1-3-7-18)20-10-8-16-9-12-25-19(16)14-21(15-19)13-17-5-4-11-24-17/h1-7,11,16,20H,8-10,12-15H2 |
| InChIKey | GZWIPDXUWWGLHJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |