C11H13FN2OS — CID 131677378
7-[(3-fluoro-2-pyridinyl)oxy]-5-thia-2-azaspiro[3.4]octane (PubChem CID 131677378) has the molecular formula C11H13FN2OS and a molecular weight of 240.30 g/mol. Its IUPAC name is 7-[(3-fluoro-2-pyridinyl)oxy]-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 7-[(3-fluoro-2-pyridinyl)oxy]-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131677378 |
| Molecular Formula | C11H13FN2OS |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 7-[(3-fluoro-2-pyridinyl)oxy]-5-thia-2-azaspiro[3.4]octane |
| SMILES | Fc1cccnc1OC1CSC2(CNC2)C1 |
| InChI | InChI=1S/C11H13FN2OS/c12-9-2-1-3-14-10(9)15-8-4-11(16-5-8)6-13-7-11/h1-3,8,13H,4-7H2 |
| InChIKey | BTLXVDDLYSXLSG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |