C17H24N2OS — CID 131677421
2-(cyclobutylmethyl)-7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octane (PubChem CID 131677421) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 2-(cyclobutylmethyl)-7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131677421 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-(cyclobutylmethyl)-7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
| SMILES | c1cncc(COC2CSC3(C2)CN(CC2CCC2)C3)c1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-14(4-1)9-19-12-17(13-19)7-16(11-21-17)20-10-15-5-2-6-18-8-15/h2,5-6,8,14,16H,1,3-4,7,9-13H2 |
| InChIKey | WMVMCNOTZYAINL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |