C17H17N3O2S — CID 131678193
pyridin-3-yl-(7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl)methanone (PubChem CID 131678193) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is pyridin-3-yl-(7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl)methanone.
| Compound Name | pyridin-3-yl-(7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl)methanone |
|---|---|
| PubChem CID | 131678193 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | pyridin-3-yl-(7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl)methanone |
| SMILES | O=C(c1cccnc1)N1CC2(CC(Oc3cccnc3)CS2)C1 |
| InChI | InChI=1S/C17H17N3O2S/c21-16(13-3-1-5-18-8-13)20-11-17(12-20)7-15(10-23-17)22-14-4-2-6-19-9-14/h1-6,8-9,15H,7,10-12H2 |
| InChIKey | FWWLCTJOBHNJOK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |