About (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone
(Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 13167991) has the molecular formula C23H26N2O5S
and a molecular weight of 442.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 13167991 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(Sc2ccccc2C(=O)N2CCN(C)CC2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H22N2OS.C4H4O4/c1-15-7-9-16(10-8-15)23-18-6-4-3-5-17(18)19(22)21-13-11-20(2)12-14-21;5-3(6)1-2-4(7)8/h3-10H,11-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ZGNHRAQHZRKLFM-BTJKTKAUSA-N |
| XLogP | 3.25 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone (CID 13167991) is (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone is Cc1ccc(Sc2ccccc2C(=O)N2CCN(C)CC2)cc1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone?
The InChIKey is ZGNHRAQHZRKLFM-BTJKTKAUSA-N. The full InChI is InChI=1S/C19H22N2OS.C4H4O4/c1-15-7-9-16(10-8-15)23-18-6-4-3-5-17(18)19(22)21-13-11-20(2)12-14-21;5-3(6)1-2-4(7)8/h3-10H,11-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone?
(Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone has a molecular weight of 442.54 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;[2-(4-methylphenyl)sulfanylphenyl]-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 13167991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).