About 2-bromo-4,5-dichloroaniline
2-bromo-4,5-dichloroaniline (PubChem CID 13168002) has the molecular formula C6H4BrCl2N
and a molecular weight of 240.91 g/mol. Its IUPAC name is 2-bromo-4,5-dichloroaniline.
Molecular Properties
| Compound Name | 2-bromo-4,5-dichloroaniline |
| PubChem CID | 13168002 |
| Molecular Formula | C6H4BrCl2N |
| Molecular Weight | 240.91 g/mol |
| Exact Mass | 238.89 |
| IUPAC Name | 2-bromo-4,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1Br |
| InChI | InChI=1S/C6H4BrCl2N/c7-3-1-4(8)5(9)2-6(3)10/h1-2H,10H2 |
| InChIKey | MAMRRASCBCVQHO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,5-dichloroaniline?
The IUPAC name of 2-bromo-4,5-dichloroaniline (CID 13168002) is 2-bromo-4,5-dichloroaniline.
What is the SMILES notation for 2-bromo-4,5-dichloroaniline?
The canonical SMILES for 2-bromo-4,5-dichloroaniline is Nc1cc(Cl)c(Cl)cc1Br.
What is the InChIKey of 2-bromo-4,5-dichloroaniline?
The InChIKey is MAMRRASCBCVQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrCl2N/c7-3-1-4(8)5(9)2-6(3)10/h1-2H,10H2.
What are the key properties of 2-bromo-4,5-dichloroaniline?
2-bromo-4,5-dichloroaniline has a molecular weight of 240.91 g/mol, XLogP of 3.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,5-dichloroaniline is sourced from PubChem (CID 13168002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).