C24H31N3O4 — CID 131680325
ethyl 9-(furan-2-ylmethyl)-2-(2-methylbenzoyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylate (PubChem CID 131680325) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 9-(furan-2-ylmethyl)-2-(2-methylbenzoyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylate.
| Compound Name | ethyl 9-(furan-2-ylmethyl)-2-(2-methylbenzoyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylate |
|---|---|
| PubChem CID | 131680325 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | ethyl 9-(furan-2-ylmethyl)-2-(2-methylbenzoyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccco2)CC2CN(C(=O)c3ccccc3C)CCN2C1 |
| InChI | InChI=1S/C24H31N3O4/c1-3-30-24(29)19-13-25(17-21-8-6-12-31-21)15-20-16-27(11-10-26(20)14-19)23(28)22-9-5-4-7-18(22)2/h4-9,12,19-20H,3,10-11,13-17H2,1-2H3 |
| InChIKey | XZLSQXMMJHAWFO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |