C16H21FN4O3 — CID 131681671
(1-fluorocyclopropyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone (PubChem CID 131681671) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is (1-fluorocyclopropyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone.
| Compound Name | (1-fluorocyclopropyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 131681671 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1-fluorocyclopropyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone |
| SMILES | O=C(N1CCOCC1c1nccc(N2CCOCC2)n1)C1(F)CC1 |
| InChI | InChI=1S/C16H21FN4O3/c17-16(2-3-16)15(22)21-7-10-24-11-12(21)14-18-4-1-13(19-14)20-5-8-23-9-6-20/h1,4,12H,2-3,5-11H2 |
| InChIKey | HCJCOHSGRNOZKX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |