C15H22F2N4O — CID 131681859
(3,3-difluorocyclobutyl)-[3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone (PubChem CID 131681859) has the molecular formula C15H22F2N4O and a molecular weight of 312.36 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone |
|---|---|
| PubChem CID | 131681859 |
| Molecular Formula | C15H22F2N4O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]methanone |
| SMILES | CN(C)Cc1cnc2n1CCN(C(=O)C1CC(F)(F)C1)CC2 |
| InChI | InChI=1S/C15H22F2N4O/c1-19(2)10-12-9-18-13-3-4-20(5-6-21(12)13)14(22)11-7-15(16,17)8-11/h9,11H,3-8,10H2,1-2H3 |
| InChIKey | LMECBQGIVBUQSH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |