C17H25F3N4O2 — CID 131682856
2-[(1S,3aR,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 131682856) has the molecular formula C17H25F3N4O2 and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(1S,3aR,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 131682856 |
| Molecular Formula | C17H25F3N4O2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[(1S,3aR,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCn1cc(CN2CC[C@@H]3[C@@H](CO[C@H]3CC(=O)NCC(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C17H25F3N4O2/c1-2-24-8-12(6-22-24)7-23-4-3-14-13(9-23)10-26-15(14)5-16(25)21-11-17(18,19)20/h6,8,13-15H,2-5,7,9-11H2,1H3,(H,21,25)/t13-,14-,15+/m1/s1 |
| InChIKey | GYMRLPOWXOVUII-KFWWJZLASA-N |
| XLogP | 1.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |