C16H19N7OS — CID 131682997
(2-methyl-1,3-thiazol-4-yl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone (PubChem CID 131682997) has the molecular formula C16H19N7OS and a molecular weight of 357.44 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131682997 |
| Molecular Formula | C16H19N7OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
| SMILES | Cc1nc(C(=O)N2CCCn3cnc(Cn4nncc4C)c3C2)cs1 |
| InChI | InChI=1S/C16H19N7OS/c1-11-6-18-20-23(11)7-13-15-8-21(4-3-5-22(15)10-17-13)16(24)14-9-25-12(2)19-14/h6,9-10H,3-5,7-8H2,1-2H3 |
| InChIKey | MJYKEVVGTXJZIQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |