C17H26N2O5S — CID 1316831
N-cyclohexyl-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 1316831) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-cyclohexyl-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-cyclohexyl-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 1316831 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-cyclohexyl-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H26N2O5S/c1-19(12-17(20)18-13-7-5-4-6-8-13)25(21,22)14-9-10-15(23-2)16(11-14)24-3/h9-11,13H,4-8,12H2,1-3H3,(H,18,20) |
| InChIKey | OPEWOYXMRATTQS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |