C16H21N3O3 — CID 131683522
1-[(4aR,7aR)-3-oxo-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile (PubChem CID 131683522) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[(4aR,7aR)-3-oxo-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[(4aR,7aR)-3-oxo-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 131683522 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[(4aR,7aR)-3-oxo-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile |
| SMILES | C=CCN1C(=O)CO[C@@H]2CN(C(=O)C3(C#N)CCCC3)C[C@H]21 |
| InChI | InChI=1S/C16H21N3O3/c1-2-7-19-12-8-18(9-13(12)22-10-14(19)20)15(21)16(11-17)5-3-4-6-16/h2,12-13H,1,3-10H2/t12-,13-/m1/s1 |
| InChIKey | IOZCYESCTDUBIY-CHWSQXEVSA-N |
| XLogP | 0.69 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|