C18H36Si6 — CID 13168388
1,1,2,2,5,5,6,6,9,9,10,10-dodecamethyl-1,2,5,6,9,10-hexasilacyclododeca-3,7,11-triyne (PubChem CID 13168388) has the molecular formula C18H36Si6 and a molecular weight of 421.00 g/mol. Its IUPAC name is 1,1,2,2,5,5,6,6,9,9,10,10-dodecamethyl-1,2,5,6,9,10-hexasilacyclododeca-3,7,11-triyne.
| Compound Name | 1,1,2,2,5,5,6,6,9,9,10,10-dodecamethyl-1,2,5,6,9,10-hexasilacyclododeca-3,7,11-triyne |
|---|---|
| PubChem CID | 13168388 |
| Molecular Formula | C18H36Si6 |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1,1,2,2,5,5,6,6,9,9,10,10-dodecamethyl-1,2,5,6,9,10-hexasilacyclododeca-3,7,11-triyne |
| SMILES | C[Si]1(C)C#C[Si](C)(C)[Si](C)(C)C#C[Si](C)(C)[Si](C)(C)C#C[Si]1(C)C |
| InChI | InChI=1S/C18H36Si6/c1-19(2)13-14-21(5,6)23(9,10)17-18-24(11,12)22(7,8)16-15-20(19,3)4/h1-12H3 |
| InChIKey | QDTVPSUSAHRZKV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|